C10H6ClFN2O2S — CID 103186726
methyl 3-(4-chloro-1,2,5-thiadiazol-3-yl)-5-fluorobenzoate (PubChem CID 103186726) has the molecular formula C10H6ClFN2O2S and a molecular weight of 272.69 g/mol. Its IUPAC name is methyl 3-(4-chloro-1,2,5-thiadiazol-3-yl)-5-fluorobenzoate.
| Compound Name | methyl 3-(4-chloro-1,2,5-thiadiazol-3-yl)-5-fluorobenzoate |
|---|---|
| PubChem CID | 103186726 |
| Molecular Formula | C10H6ClFN2O2S |
| Molecular Weight | 272.69 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | methyl 3-(4-chloro-1,2,5-thiadiazol-3-yl)-5-fluorobenzoate |
| SMILES | COC(=O)c1cc(F)cc(-c2nsnc2Cl)c1 |
| InChI | InChI=1S/C10H6ClFN2O2S/c1-16-10(15)6-2-5(3-7(12)4-6)8-9(11)14-17-13-8/h2-4H,1H3 |
| InChIKey | PGLYZZDFSQUDMA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.69 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |