methyl 3-(4-chloro-1,2,5-thiadiazol-3-yl)-5-fluorobenzoate

C10H6ClFN2O2S — CID 103186726

IUPACmethyl 3-(4-chloro-1,2,5-thiadiazol-3-yl)-5-fluorobenzoate
SMILESCOC(=O)c1cc(F)cc(-c2nsnc2Cl)c1
InChIInChI=1S/C10H6ClFN2O2S/c1-16-10(15)6-2-5(3-7(12)4-6)8-9(11)14-17-13-8/h2-4H,1H3
InChIKeyPGLYZZDFSQUDMA-UHFFFAOYSA-N
MW272.69 g/mol
LogP2.78
Rot. Bonds2

About methyl 3-(4-chloro-1,2,5-thiadiazol-3-yl)-5-fluorobenzoate

methyl 3-(4-chloro-1,2,5-thiadiazol-3-yl)-5-fluorobenzoate (PubChem CID 103186726) has the molecular formula C10H6ClFN2O2S and a molecular weight of 272.69 g/mol. Its IUPAC name is methyl 3-(4-chloro-1,2,5-thiadiazol-3-yl)-5-fluorobenzoate.

Molecular Properties

Compound Namemethyl 3-(4-chloro-1,2,5-thiadiazol-3-yl)-5-fluorobenzoate
PubChem CID103186726
Molecular FormulaC10H6ClFN2O2S
Molecular Weight272.69 g/mol
Exact Mass271.98
IUPAC Namemethyl 3-(4-chloro-1,2,5-thiadiazol-3-yl)-5-fluorobenzoate
SMILESCOC(=O)c1cc(F)cc(-c2nsnc2Cl)c1
InChIInChI=1S/C10H6ClFN2O2S/c1-16-10(15)6-2-5(3-7(12)4-6)8-9(11)14-17-13-8/h2-4H,1H3
InChIKeyPGLYZZDFSQUDMA-UHFFFAOYSA-N
XLogP2.78
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.69
LogP ≤ 52.78
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 3-(4-chloro-1,2,5-thiadiazol-3-yl)-5-fluorobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(4-chloro-1,2,5-thiadiazol-3-yl)-5-fluorobenzoate?
The IUPAC name of methyl 3-(4-chloro-1,2,5-thiadiazol-3-yl)-5-fluorobenzoate (CID 103186726) is methyl 3-(4-chloro-1,2,5-thiadiazol-3-yl)-5-fluorobenzoate.
What is the SMILES notation for methyl 3-(4-chloro-1,2,5-thiadiazol-3-yl)-5-fluorobenzoate?
The canonical SMILES for methyl 3-(4-chloro-1,2,5-thiadiazol-3-yl)-5-fluorobenzoate is COC(=O)c1cc(F)cc(-c2nsnc2Cl)c1.
What is the InChIKey of methyl 3-(4-chloro-1,2,5-thiadiazol-3-yl)-5-fluorobenzoate?
The InChIKey is PGLYZZDFSQUDMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6ClFN2O2S/c1-16-10(15)6-2-5(3-7(12)4-6)8-9(11)14-17-13-8/h2-4H,1H3.
What are the key properties of methyl 3-(4-chloro-1,2,5-thiadiazol-3-yl)-5-fluorobenzoate?
methyl 3-(4-chloro-1,2,5-thiadiazol-3-yl)-5-fluorobenzoate has a molecular weight of 272.69 g/mol, XLogP of 2.78, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(4-chloro-1,2,5-thiadiazol-3-yl)-5-fluorobenzoate is sourced from PubChem (CID 103186726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).