C15H15FN2O3 — CID 136770487
methyl 3-fluoro-5-(6-oxo-5-propyl-1H-pyrimidin-4-yl)benzoate (PubChem CID 136770487) has the molecular formula C15H15FN2O3 and a molecular weight of 290.29 g/mol. Its IUPAC name is methyl 3-fluoro-5-(6-oxo-5-propyl-1H-pyrimidin-4-yl)benzoate.
| Compound Name | methyl 3-fluoro-5-(6-oxo-5-propyl-1H-pyrimidin-4-yl)benzoate |
|---|---|
| PubChem CID | 136770487 |
| Molecular Formula | C15H15FN2O3 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | methyl 3-fluoro-5-(6-oxo-5-propyl-1H-pyrimidin-4-yl)benzoate |
| SMILES | CCCc1c(-c2cc(F)cc(C(=O)OC)c2)nc[nH]c1=O |
| InChI | InChI=1S/C15H15FN2O3/c1-3-4-12-13(17-8-18-14(12)19)9-5-10(15(20)21-2)7-11(16)6-9/h5-8H,3-4H2,1-2H3,(H,17,18,19) |
| InChIKey | QHVRBFWPJKMHQO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |