C17H17FO3 — CID 106681057
methyl 3-fluoro-5-(2-methoxy-4,6-dimethylphenyl)benzoate (PubChem CID 106681057) has the molecular formula C17H17FO3 and a molecular weight of 288.32 g/mol. Its IUPAC name is methyl 3-fluoro-5-(2-methoxy-4,6-dimethylphenyl)benzoate.
| Compound Name | methyl 3-fluoro-5-(2-methoxy-4,6-dimethylphenyl)benzoate |
|---|---|
| PubChem CID | 106681057 |
| Molecular Formula | C17H17FO3 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | methyl 3-fluoro-5-(2-methoxy-4,6-dimethylphenyl)benzoate |
| SMILES | COC(=O)c1cc(F)cc(-c2c(C)cc(C)cc2OC)c1 |
| InChI | InChI=1S/C17H17FO3/c1-10-5-11(2)16(15(6-10)20-3)12-7-13(17(19)21-4)9-14(18)8-12/h5-9H,1-4H3 |
| InChIKey | GYHAXHRBMBDFGT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |