methyl 3-fluoro-5-(2-methoxy-4,6-dimethylphenyl)benzoate

C17H17FO3 — CID 106681057

IUPACmethyl 3-fluoro-5-(2-methoxy-4,6-dimethylphenyl)benzoate
SMILESCOC(=O)c1cc(F)cc(-c2c(C)cc(C)cc2OC)c1
InChIInChI=1S/C17H17FO3/c1-10-5-11(2)16(15(6-10)20-3)12-7-13(17(19)21-4)9-14(18)8-12/h5-9H,1-4H3
InChIKeyGYHAXHRBMBDFGT-UHFFFAOYSA-N
MW288.32 g/mol
LogP3.90
Rot. Bonds3

About methyl 3-fluoro-5-(2-methoxy-4,6-dimethylphenyl)benzoate

methyl 3-fluoro-5-(2-methoxy-4,6-dimethylphenyl)benzoate (PubChem CID 106681057) has the molecular formula C17H17FO3 and a molecular weight of 288.32 g/mol. Its IUPAC name is methyl 3-fluoro-5-(2-methoxy-4,6-dimethylphenyl)benzoate.

Molecular Properties

Compound Namemethyl 3-fluoro-5-(2-methoxy-4,6-dimethylphenyl)benzoate
PubChem CID106681057
Molecular FormulaC17H17FO3
Molecular Weight288.32 g/mol
Exact Mass288.12
IUPAC Namemethyl 3-fluoro-5-(2-methoxy-4,6-dimethylphenyl)benzoate
SMILESCOC(=O)c1cc(F)cc(-c2c(C)cc(C)cc2OC)c1
InChIInChI=1S/C17H17FO3/c1-10-5-11(2)16(15(6-10)20-3)12-7-13(17(19)21-4)9-14(18)8-12/h5-9H,1-4H3
InChIKeyGYHAXHRBMBDFGT-UHFFFAOYSA-N
XLogP3.90
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.32
LogP ≤ 53.90
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 3-fluoro-5-(2-methoxy-4,6-dimethylphenyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-fluoro-5-(2-methoxy-4,6-dimethylphenyl)benzoate?
The IUPAC name of methyl 3-fluoro-5-(2-methoxy-4,6-dimethylphenyl)benzoate (CID 106681057) is methyl 3-fluoro-5-(2-methoxy-4,6-dimethylphenyl)benzoate.
What is the SMILES notation for methyl 3-fluoro-5-(2-methoxy-4,6-dimethylphenyl)benzoate?
The canonical SMILES for methyl 3-fluoro-5-(2-methoxy-4,6-dimethylphenyl)benzoate is COC(=O)c1cc(F)cc(-c2c(C)cc(C)cc2OC)c1.
What is the InChIKey of methyl 3-fluoro-5-(2-methoxy-4,6-dimethylphenyl)benzoate?
The InChIKey is GYHAXHRBMBDFGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17FO3/c1-10-5-11(2)16(15(6-10)20-3)12-7-13(17(19)21-4)9-14(18)8-12/h5-9H,1-4H3.
What are the key properties of methyl 3-fluoro-5-(2-methoxy-4,6-dimethylphenyl)benzoate?
methyl 3-fluoro-5-(2-methoxy-4,6-dimethylphenyl)benzoate has a molecular weight of 288.32 g/mol, XLogP of 3.90, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-fluoro-5-(2-methoxy-4,6-dimethylphenyl)benzoate is sourced from PubChem (CID 106681057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).