C17H27N3O6S — CID 10318869
tert-butyl 5-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-2-sulfanylidene-1H-imidazole-3-carboxylate (PubChem CID 10318869) has the molecular formula C17H27N3O6S and a molecular weight of 401.49 g/mol. Its IUPAC name is tert-butyl 5-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-2-sulfanylidene-1H-imidazole-3-carboxylate.
| Compound Name | tert-butyl 5-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-2-sulfanylidene-1H-imidazole-3-carboxylate |
|---|---|
| PubChem CID | 10318869 |
| Molecular Formula | C17H27N3O6S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | tert-butyl 5-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-2-sulfanylidene-1H-imidazole-3-carboxylate |
| SMILES | COC(=O)[C@H](Cc1cn(C(=O)OC(C)(C)C)c(=S)[nH]1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H27N3O6S/c1-16(2,3)25-14(22)19-11(12(21)24-7)8-10-9-20(13(27)18-10)15(23)26-17(4,5)6/h9,11H,8H2,1-7H3,(H,18,27)(H,19,22)/t11-/m0/s1 |
| InChIKey | WWTVDYYRASALHS-NSHDSACASA-N |
| XLogP | 2.94 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|