C15H22FN3 — CID 103188917
3-[[1-(dimethylamino)propan-2-yl-ethylamino]methyl]-4-fluorobenzonitrile (PubChem CID 103188917) has the molecular formula C15H22FN3 and a molecular weight of 263.36 g/mol. Its IUPAC name is 3-[[1-(dimethylamino)propan-2-yl-ethylamino]methyl]-4-fluorobenzonitrile.
| Compound Name | 3-[[1-(dimethylamino)propan-2-yl-ethylamino]methyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 103188917 |
| Molecular Formula | C15H22FN3 |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.18 |
| IUPAC Name | 3-[[1-(dimethylamino)propan-2-yl-ethylamino]methyl]-4-fluorobenzonitrile |
| SMILES | CCN(Cc1cc(C#N)ccc1F)C(C)CN(C)C |
| InChI | InChI=1S/C15H22FN3/c1-5-19(12(2)10-18(3)4)11-14-8-13(9-17)6-7-15(14)16/h6-8,12H,5,10-11H2,1-4H3 |
| InChIKey | VLVZTGPEXUURRH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |