C17H24BrNO3S — CID 10318908
(3S,4R)-4-(bromomethyl)-1-tert-butyl-3-[(4-methylphenyl)sulfonylmethyl]pyrrolidin-2-one (PubChem CID 10318908) has the molecular formula C17H24BrNO3S and a molecular weight of 402.35 g/mol. Its IUPAC name is (3S,4R)-4-(bromomethyl)-1-tert-butyl-3-[(4-methylphenyl)sulfonylmethyl]pyrrolidin-2-one.
| Compound Name | (3S,4R)-4-(bromomethyl)-1-tert-butyl-3-[(4-methylphenyl)sulfonylmethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 10318908 |
| Molecular Formula | C17H24BrNO3S |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | (3S,4R)-4-(bromomethyl)-1-tert-butyl-3-[(4-methylphenyl)sulfonylmethyl]pyrrolidin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)C[C@@H]2C(=O)N(C(C)(C)C)C[C@@H]2CBr)cc1 |
| InChI | InChI=1S/C17H24BrNO3S/c1-12-5-7-14(8-6-12)23(21,22)11-15-13(9-18)10-19(16(15)20)17(2,3)4/h5-8,13,15H,9-11H2,1-4H3/t13-,15-/m0/s1 |
| InChIKey | KDXZWNKFCQYUSB-ZFWWWQNUSA-N |
| XLogP | 3.04 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|