C19H27NO5S — CID 170166861
tert-butyl 4-methyl-3-[2-(4-methylphenyl)sulfonylethyl]-2-oxopyrrolidine-1-carboxylate (PubChem CID 170166861) has the molecular formula C19H27NO5S and a molecular weight of 381.49 g/mol. Its IUPAC name is tert-butyl 4-methyl-3-[2-(4-methylphenyl)sulfonylethyl]-2-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-methyl-3-[2-(4-methylphenyl)sulfonylethyl]-2-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 170166861 |
| Molecular Formula | C19H27NO5S |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | tert-butyl 4-methyl-3-[2-(4-methylphenyl)sulfonylethyl]-2-oxopyrrolidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)CCC2C(=O)N(C(=O)OC(C)(C)C)CC2C)cc1 |
| InChI | InChI=1S/C19H27NO5S/c1-13-6-8-15(9-7-13)26(23,24)11-10-16-14(2)12-20(17(16)21)18(22)25-19(3,4)5/h6-9,14,16H,10-12H2,1-5H3 |
| InChIKey | MIOPXIABIMQUOR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |