C22H28O7 — CID 10319039
(17R)-17-ethoxycarbonyloxy-11-hydroxy-10-methyl-3-oxo-6,7,8,9,11,12,13,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carboxylic acid (PubChem CID 10319039) has the molecular formula C22H28O7 and a molecular weight of 404.46 g/mol. Its IUPAC name is (17R)-17-ethoxycarbonyloxy-11-hydroxy-10-methyl-3-oxo-6,7,8,9,11,12,13,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carboxylic acid.
| Compound Name | (17R)-17-ethoxycarbonyloxy-11-hydroxy-10-methyl-3-oxo-6,7,8,9,11,12,13,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
|---|---|
| PubChem CID | 10319039 |
| Molecular Formula | C22H28O7 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | (17R)-17-ethoxycarbonyloxy-11-hydroxy-10-methyl-3-oxo-6,7,8,9,11,12,13,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
| SMILES | CCOC(=O)O[C@]1(C(=O)O)CCC2C3CCC4=CC(=O)C=CC4(C)C3C(O)CC21 |
| InChI | InChI=1S/C22H28O7/c1-3-28-20(27)29-22(19(25)26)9-7-14-15-5-4-12-10-13(23)6-8-21(12,2)18(15)17(24)11-16(14)22/h6,8,10,14-18,24H,3-5,7,9,11H2,1-2H3,(H,25,26)/t14?,15?,16?,17?,18?,21?,22-/m1/s1 |
| InChIKey | IZMIBNNSPCIQQC-HZDDBBQTSA-N |
| XLogP | 2.87 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |