C20H27NO4 — CID 171137981
(8S,9S,10R,11S,13S,14S,17R)-17-(2-aminoacetyl)-11,17-dihydroxy-10-methyl-6,7,8,9,11,12,13,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 171137981) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is (8S,9S,10R,11S,13S,14S,17R)-17-(2-aminoacetyl)-11,17-dihydroxy-10-methyl-6,7,8,9,11,12,13,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,11S,13S,14S,17R)-17-(2-aminoacetyl)-11,17-dihydroxy-10-methyl-6,7,8,9,11,12,13,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 171137981 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | (8S,9S,10R,11S,13S,14S,17R)-17-(2-aminoacetyl)-11,17-dihydroxy-10-methyl-6,7,8,9,11,12,13,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@H]1[C@@H]3CC[C@](O)(C(=O)CN)[C@H]3C[C@H](O)[C@@H]12 |
| InChI | InChI=1S/C20H27NO4/c1-19-6-4-12(22)8-11(19)2-3-14-13-5-7-20(25,17(24)10-21)15(13)9-16(23)18(14)19/h4,6,8,13-16,18,23,25H,2-3,5,7,9-10,21H2,1H3/t13-,14-,15-,16-,18+,19-,20+/m0/s1 |
| InChIKey | BJMCVSPTAJZVJO-XOJCLWECSA-N |
| XLogP | 1.13 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |