C22H32O4 — CID 142196562
ethyl acetate;11-hydroxy-10-methyl-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 142196562) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is ethyl acetate;11-hydroxy-10-methyl-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | ethyl acetate;11-hydroxy-10-methyl-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 142196562 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | ethyl acetate;11-hydroxy-10-methyl-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC12C=CC(=O)C=C1CCC1C3CCCC3CC(O)C12.CCOC(C)=O |
| InChI | InChI=1S/C18H24O2.C4H8O2/c1-18-8-7-13(19)10-12(18)5-6-15-14-4-2-3-11(14)9-16(20)17(15)18;1-3-6-4(2)5/h7-8,10-11,14-17,20H,2-6,9H2,1H3;3H2,1-2H3 |
| InChIKey | PWCACRRRYKIDML-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |