C11H13F3INO2S — CID 10319199
N-benzyl-1,1,1-trifluoro-N-(3-iodopropyl)methanesulfonamide (PubChem CID 10319199) has the molecular formula C11H13F3INO2S and a molecular weight of 407.20 g/mol. Its IUPAC name is N-benzyl-1,1,1-trifluoro-N-(3-iodopropyl)methanesulfonamide.
| Compound Name | N-benzyl-1,1,1-trifluoro-N-(3-iodopropyl)methanesulfonamide |
|---|---|
| PubChem CID | 10319199 |
| Molecular Formula | C11H13F3INO2S |
| Molecular Weight | 407.20 g/mol |
| Exact Mass | 406.97 |
| IUPAC Name | N-benzyl-1,1,1-trifluoro-N-(3-iodopropyl)methanesulfonamide |
| SMILES | O=S(=O)(N(CCCI)Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H13F3INO2S/c12-11(13,14)19(17,18)16(8-4-7-15)9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2 |
| InChIKey | BARGDVQEPNZPFP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.20 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|