C13H14F3NO3S — CID 10947197
(1-benzyl-3,6-dihydro-2H-pyridin-5-yl) trifluoromethanesulfonate (PubChem CID 10947197) has the molecular formula C13H14F3NO3S and a molecular weight of 321.32 g/mol. Its IUPAC name is (1-benzyl-3,6-dihydro-2H-pyridin-5-yl) trifluoromethanesulfonate.
| Compound Name | (1-benzyl-3,6-dihydro-2H-pyridin-5-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10947197 |
| Molecular Formula | C13H14F3NO3S |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | (1-benzyl-3,6-dihydro-2H-pyridin-5-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC1=CCCN(Cc2ccccc2)C1)C(F)(F)F |
| InChI | InChI=1S/C13H14F3NO3S/c14-13(15,16)21(18,19)20-12-7-4-8-17(10-12)9-11-5-2-1-3-6-11/h1-3,5-7H,4,8-10H2 |
| InChIKey | GULHXFBEZNZEBE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|