C11H19N5O8P2 — CID 10319421
[4-[6-(methylamino)purin-9-yl]-2-(phosphonooxymethyl)butyl] dihydrogen phosphate (PubChem CID 10319421) has the molecular formula C11H19N5O8P2 and a molecular weight of 411.25 g/mol. Its IUPAC name is [4-[6-(methylamino)purin-9-yl]-2-(phosphonooxymethyl)butyl] dihydrogen phosphate.
| Compound Name | [4-[6-(methylamino)purin-9-yl]-2-(phosphonooxymethyl)butyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 10319421 |
| Molecular Formula | C11H19N5O8P2 |
| Molecular Weight | 411.25 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | [4-[6-(methylamino)purin-9-yl]-2-(phosphonooxymethyl)butyl] dihydrogen phosphate |
| SMILES | CNc1ncnc2c1ncn2CCC(COP(=O)(O)O)COP(=O)(O)O |
| InChI | InChI=1S/C11H19N5O8P2/c1-12-10-9-11(14-6-13-10)16(7-15-9)3-2-8(4-23-25(17,18)19)5-24-26(20,21)22/h6-8H,2-5H2,1H3,(H,12,13,14)(H2,17,18,19)(H2,20,21,22) |
| InChIKey | AUZJPSRVAZOKSZ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 189.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.25 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|