C14H21N5O2 — CID 103197680
1-(5-tert-butyl-1H-1,2,4-triazole-3-carbonyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 103197680) has the molecular formula C14H21N5O2 and a molecular weight of 291.36 g/mol. Its IUPAC name is 1-(5-tert-butyl-1H-1,2,4-triazole-3-carbonyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 1-(5-tert-butyl-1H-1,2,4-triazole-3-carbonyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 103197680 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 1-(5-tert-butyl-1H-1,2,4-triazole-3-carbonyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | CC(C)(C)c1nc(C(=O)N2CCCC3C(=O)NCC32)n[nH]1 |
| InChI | InChI=1S/C14H21N5O2/c1-14(2,3)13-16-10(17-18-13)12(21)19-6-4-5-8-9(19)7-15-11(8)20/h8-9H,4-7H2,1-3H3,(H,15,20)(H,16,17,18) |
| InChIKey | YCAKEQMTCOEUCO-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |