C14H13F2N3S — CID 103202488
4-[[2-(difluoromethylsulfanyl)anilino]methyl]-1-methylpyrrole-2-carbonitrile (PubChem CID 103202488) has the molecular formula C14H13F2N3S and a molecular weight of 293.34 g/mol. Its IUPAC name is 4-[[2-(difluoromethylsulfanyl)anilino]methyl]-1-methylpyrrole-2-carbonitrile.
| Compound Name | 4-[[2-(difluoromethylsulfanyl)anilino]methyl]-1-methylpyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 103202488 |
| Molecular Formula | C14H13F2N3S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 4-[[2-(difluoromethylsulfanyl)anilino]methyl]-1-methylpyrrole-2-carbonitrile |
| SMILES | Cn1cc(CNc2ccccc2SC(F)F)cc1C#N |
| InChI | InChI=1S/C14H13F2N3S/c1-19-9-10(6-11(19)7-17)8-18-12-4-2-3-5-13(12)20-14(15)16/h2-6,9,14,18H,8H2,1H3 |
| InChIKey | PZUNFBLHVXRSGP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 40.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |