C15H13N5S — CID 103203923
4-[1,2,4-benzotriazin-3-yl(methyl)amino]benzenecarbothioamide (PubChem CID 103203923) has the molecular formula C15H13N5S and a molecular weight of 295.37 g/mol. Its IUPAC name is 4-[1,2,4-benzotriazin-3-yl(methyl)amino]benzenecarbothioamide.
| Compound Name | 4-[1,2,4-benzotriazin-3-yl(methyl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 103203923 |
| Molecular Formula | C15H13N5S |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 4-[1,2,4-benzotriazin-3-yl(methyl)amino]benzenecarbothioamide |
| SMILES | CN(c1ccc(C(N)=S)cc1)c1nnc2ccccc2n1 |
| InChI | InChI=1S/C15H13N5S/c1-20(11-8-6-10(7-9-11)14(16)21)15-17-12-4-2-3-5-13(12)18-19-15/h2-9H,1H3,(H2,16,21) |
| InChIKey | FBGJPYOHUVQLON-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|