C14H18N4O — CID 103205004
2-(1,2,4-benzotriazin-3-yloxy)-N-methylcyclohexan-1-amine (PubChem CID 103205004) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-(1,2,4-benzotriazin-3-yloxy)-N-methylcyclohexan-1-amine.
| Compound Name | 2-(1,2,4-benzotriazin-3-yloxy)-N-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 103205004 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 2-(1,2,4-benzotriazin-3-yloxy)-N-methylcyclohexan-1-amine |
| SMILES | CNC1CCCCC1Oc1nnc2ccccc2n1 |
| InChI | InChI=1S/C14H18N4O/c1-15-12-8-4-5-9-13(12)19-14-16-10-6-2-3-7-11(10)17-18-14/h2-3,6-7,12-13,15H,4-5,8-9H2,1H3 |
| InChIKey | OQGQMQQVSVVGBN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |