C10H16F2N4O2 — CID 103205496
N-[4-(aminomethyl)-1-methylpyrazol-3-yl]-3-(2,2-difluoroethoxy)propanamide (PubChem CID 103205496) has the molecular formula C10H16F2N4O2 and a molecular weight of 262.26 g/mol. Its IUPAC name is N-[4-(aminomethyl)-1-methylpyrazol-3-yl]-3-(2,2-difluoroethoxy)propanamide.
| Compound Name | N-[4-(aminomethyl)-1-methylpyrazol-3-yl]-3-(2,2-difluoroethoxy)propanamide |
|---|---|
| PubChem CID | 103205496 |
| Molecular Formula | C10H16F2N4O2 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | N-[4-(aminomethyl)-1-methylpyrazol-3-yl]-3-(2,2-difluoroethoxy)propanamide |
| SMILES | Cn1cc(CN)c(NC(=O)CCOCC(F)F)n1 |
| InChI | InChI=1S/C10H16F2N4O2/c1-16-5-7(4-13)10(15-16)14-9(17)2-3-18-6-8(11)12/h5,8H,2-4,6,13H2,1H3,(H,14,15,17) |
| InChIKey | SIXOVKNWTFYWAW-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|