C10H11F3N4O2 — CID 103208288
N-(4-cyano-1-methylpyrazol-5-yl)-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 103208288) has the molecular formula C10H11F3N4O2 and a molecular weight of 276.22 g/mol. Its IUPAC name is N-(4-cyano-1-methylpyrazol-5-yl)-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-(4-cyano-1-methylpyrazol-5-yl)-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 103208288 |
| Molecular Formula | C10H11F3N4O2 |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | N-(4-cyano-1-methylpyrazol-5-yl)-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | Cn1ncc(C#N)c1NC(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C10H11F3N4O2/c1-17-9(7(4-14)5-15-17)16-8(18)2-3-19-6-10(11,12)13/h5H,2-3,6H2,1H3,(H,16,18) |
| InChIKey | VJUSMFHVIDJLET-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|