C10H12F2N4O2 — CID 103208297
N-(4-cyano-1-methylpyrazol-3-yl)-3-(2,2-difluoroethoxy)propanamide (PubChem CID 103208297) has the molecular formula C10H12F2N4O2 and a molecular weight of 258.23 g/mol. Its IUPAC name is N-(4-cyano-1-methylpyrazol-3-yl)-3-(2,2-difluoroethoxy)propanamide.
| Compound Name | N-(4-cyano-1-methylpyrazol-3-yl)-3-(2,2-difluoroethoxy)propanamide |
|---|---|
| PubChem CID | 103208297 |
| Molecular Formula | C10H12F2N4O2 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | N-(4-cyano-1-methylpyrazol-3-yl)-3-(2,2-difluoroethoxy)propanamide |
| SMILES | Cn1cc(C#N)c(NC(=O)CCOCC(F)F)n1 |
| InChI | InChI=1S/C10H12F2N4O2/c1-16-5-7(4-13)10(15-16)14-9(17)2-3-18-6-8(11)12/h5,8H,2-3,6H2,1H3,(H,14,15,17) |
| InChIKey | GOOWSVNRILJUDW-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|