C10H14F2N4O4 — CID 103206086
1-[2-[3-(2,2-difluoroethoxy)propanoylamino]ethyl]triazole-4-carboxylic acid (PubChem CID 103206086) has the molecular formula C10H14F2N4O4 and a molecular weight of 292.24 g/mol. Its IUPAC name is 1-[2-[3-(2,2-difluoroethoxy)propanoylamino]ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-[3-(2,2-difluoroethoxy)propanoylamino]ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103206086 |
| Molecular Formula | C10H14F2N4O4 |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-[2-[3-(2,2-difluoroethoxy)propanoylamino]ethyl]triazole-4-carboxylic acid |
| SMILES | O=C(CCOCC(F)F)NCCn1cc(C(=O)O)nn1 |
| InChI | InChI=1S/C10H14F2N4O4/c11-8(12)6-20-4-1-9(17)13-2-3-16-5-7(10(18)19)14-15-16/h5,8H,1-4,6H2,(H,13,17)(H,18,19) |
| InChIKey | SGJDLXAXIZVBMO-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|