C11H21F2N3O2 — CID 103206343
3-(2,2-difluoroethoxy)-N-(2-piperazin-1-ylethyl)propanamide (PubChem CID 103206343) has the molecular formula C11H21F2N3O2 and a molecular weight of 265.30 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-(2-piperazin-1-ylethyl)propanamide.
| Compound Name | 3-(2,2-difluoroethoxy)-N-(2-piperazin-1-ylethyl)propanamide |
|---|---|
| PubChem CID | 103206343 |
| Molecular Formula | C11H21F2N3O2 |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-(2-piperazin-1-ylethyl)propanamide |
| SMILES | O=C(CCOCC(F)F)NCCN1CCNCC1 |
| InChI | InChI=1S/C11H21F2N3O2/c12-10(13)9-18-8-1-11(17)15-4-7-16-5-2-14-3-6-16/h10,14H,1-9H2,(H,15,17) |
| InChIKey | QJXMXVUDIIJKFP-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|