C10H17F2NO4S — CID 103206261
(2R)-2-[3-(2,2-difluoroethoxy)propanoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 103206261) has the molecular formula C10H17F2NO4S and a molecular weight of 285.31 g/mol. Its IUPAC name is (2R)-2-[3-(2,2-difluoroethoxy)propanoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[3-(2,2-difluoroethoxy)propanoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 103206261 |
| Molecular Formula | C10H17F2NO4S |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | (2R)-2-[3-(2,2-difluoroethoxy)propanoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](NC(=O)CCOCC(F)F)C(=O)O |
| InChI | InChI=1S/C10H17F2NO4S/c1-18-5-3-7(10(15)16)13-9(14)2-4-17-6-8(11)12/h7-8H,2-6H2,1H3,(H,13,14)(H,15,16)/t7-/m1/s1 |
| InChIKey | OMFXYYUUORDVBD-SSDOTTSWSA-N |
| XLogP | 0.98 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|