C10H14F2O2 — CID 103206646
1-(cyclopenten-1-yl)-3-(2,2-difluoroethoxy)propan-1-one (PubChem CID 103206646) has the molecular formula C10H14F2O2 and a molecular weight of 204.22 g/mol. Its IUPAC name is 1-(cyclopenten-1-yl)-3-(2,2-difluoroethoxy)propan-1-one.
| Compound Name | 1-(cyclopenten-1-yl)-3-(2,2-difluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 103206646 |
| Molecular Formula | C10H14F2O2 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 1-(cyclopenten-1-yl)-3-(2,2-difluoroethoxy)propan-1-one |
| SMILES | O=C(CCOCC(F)F)C1=CCCC1 |
| InChI | InChI=1S/C10H14F2O2/c11-10(12)7-14-6-5-9(13)8-3-1-2-4-8/h3,10H,1-2,4-7H2 |
| InChIKey | SCDUYFBDMSTIQT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|