C12H17F3O2 — CID 103206650
1-(cyclohepten-1-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one (PubChem CID 103206650) has the molecular formula C12H17F3O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is 1-(cyclohepten-1-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one.
| Compound Name | 1-(cyclohepten-1-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 103206650 |
| Molecular Formula | C12H17F3O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 1-(cyclohepten-1-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
| SMILES | O=C(CCOCC(F)(F)F)C1=CCCCCC1 |
| InChI | InChI=1S/C12H17F3O2/c13-12(14,15)9-17-8-7-11(16)10-5-3-1-2-4-6-10/h5H,1-4,6-9H2 |
| InChIKey | ZINVQVVYUZBFPD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|