C11H15F3O2 — CID 103206651
1-(cyclohepten-1-yl)-2-(2,2,2-trifluoroethoxy)ethanone (PubChem CID 103206651) has the molecular formula C11H15F3O2 and a molecular weight of 236.23 g/mol. Its IUPAC name is 1-(cyclohepten-1-yl)-2-(2,2,2-trifluoroethoxy)ethanone.
| Compound Name | 1-(cyclohepten-1-yl)-2-(2,2,2-trifluoroethoxy)ethanone |
|---|---|
| PubChem CID | 103206651 |
| Molecular Formula | C11H15F3O2 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 1-(cyclohepten-1-yl)-2-(2,2,2-trifluoroethoxy)ethanone |
| SMILES | O=C(COCC(F)(F)F)C1=CCCCCC1 |
| InChI | InChI=1S/C11H15F3O2/c12-11(13,14)8-16-7-10(15)9-5-3-1-2-4-6-9/h5H,1-4,6-8H2 |
| InChIKey | CJBZIWUIDJAOJH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |