C14H20ClIN2 — CID 103208125
N-[(3-chloro-4-iodophenyl)methyl]-1-pyrrolidin-1-ylpropan-2-amine (PubChem CID 103208125) has the molecular formula C14H20ClIN2 and a molecular weight of 378.69 g/mol. Its IUPAC name is N-[(3-chloro-4-iodophenyl)methyl]-1-pyrrolidin-1-ylpropan-2-amine.
| Compound Name | N-[(3-chloro-4-iodophenyl)methyl]-1-pyrrolidin-1-ylpropan-2-amine |
|---|---|
| PubChem CID | 103208125 |
| Molecular Formula | C14H20ClIN2 |
| Molecular Weight | 378.69 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | N-[(3-chloro-4-iodophenyl)methyl]-1-pyrrolidin-1-ylpropan-2-amine |
| SMILES | CC(CN1CCCC1)NCc1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C14H20ClIN2/c1-11(10-18-6-2-3-7-18)17-9-12-4-5-14(16)13(15)8-12/h4-5,8,11,17H,2-3,6-7,9-10H2,1H3 |
| InChIKey | DMEREWLKPUPGGC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.69 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|