C14H22ClIN2 — CID 103208117
2-N-[(3-chloro-4-iodophenyl)methyl]-1-N-(2-methylpropyl)propane-1,2-diamine (PubChem CID 103208117) has the molecular formula C14H22ClIN2 and a molecular weight of 380.70 g/mol. Its IUPAC name is 2-N-[(3-chloro-4-iodophenyl)methyl]-1-N-(2-methylpropyl)propane-1,2-diamine.
| Compound Name | 2-N-[(3-chloro-4-iodophenyl)methyl]-1-N-(2-methylpropyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 103208117 |
| Molecular Formula | C14H22ClIN2 |
| Molecular Weight | 380.70 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 2-N-[(3-chloro-4-iodophenyl)methyl]-1-N-(2-methylpropyl)propane-1,2-diamine |
| SMILES | CC(C)CNCC(C)NCc1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C14H22ClIN2/c1-10(2)7-17-8-11(3)18-9-12-4-5-14(16)13(15)6-12/h4-6,10-11,17-18H,7-9H2,1-3H3 |
| InChIKey | FZDWYTLKRRJNOR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.70 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|