C13H14F2N2O3 — CID 103208208
N-[2-(cyanomethoxy)phenyl]-3-(2,2-difluoroethoxy)propanamide (PubChem CID 103208208) has the molecular formula C13H14F2N2O3 and a molecular weight of 284.26 g/mol. Its IUPAC name is N-[2-(cyanomethoxy)phenyl]-3-(2,2-difluoroethoxy)propanamide.
| Compound Name | N-[2-(cyanomethoxy)phenyl]-3-(2,2-difluoroethoxy)propanamide |
|---|---|
| PubChem CID | 103208208 |
| Molecular Formula | C13H14F2N2O3 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | N-[2-(cyanomethoxy)phenyl]-3-(2,2-difluoroethoxy)propanamide |
| SMILES | N#CCOc1ccccc1NC(=O)CCOCC(F)F |
| InChI | InChI=1S/C13H14F2N2O3/c14-12(15)9-19-7-5-13(18)17-10-3-1-2-4-11(10)20-8-6-16/h1-4,12H,5,7-9H2,(H,17,18) |
| InChIKey | HWDUJLYENUENGU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|