C10H8F2N2O2 — CID 103513721
N-[2-(cyanomethoxy)phenyl]-2,2-difluoroacetamide (PubChem CID 103513721) has the molecular formula C10H8F2N2O2 and a molecular weight of 226.18 g/mol. Its IUPAC name is N-[2-(cyanomethoxy)phenyl]-2,2-difluoroacetamide.
| Compound Name | N-[2-(cyanomethoxy)phenyl]-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 103513721 |
| Molecular Formula | C10H8F2N2O2 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | N-[2-(cyanomethoxy)phenyl]-2,2-difluoroacetamide |
| SMILES | N#CCOc1ccccc1NC(=O)C(F)F |
| InChI | InChI=1S/C10H8F2N2O2/c11-9(12)10(15)14-7-3-1-2-4-8(7)16-6-5-13/h1-4,9H,6H2,(H,14,15) |
| InChIKey | JIMWICHLPCJMTB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |