C9H12F2N4O2S — CID 103208461
N-(4-carbamothioyl-1H-pyrazol-5-yl)-3-(2,2-difluoroethoxy)propanamide (PubChem CID 103208461) has the molecular formula C9H12F2N4O2S and a molecular weight of 278.28 g/mol. Its IUPAC name is N-(4-carbamothioyl-1H-pyrazol-5-yl)-3-(2,2-difluoroethoxy)propanamide.
| Compound Name | N-(4-carbamothioyl-1H-pyrazol-5-yl)-3-(2,2-difluoroethoxy)propanamide |
|---|---|
| PubChem CID | 103208461 |
| Molecular Formula | C9H12F2N4O2S |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | N-(4-carbamothioyl-1H-pyrazol-5-yl)-3-(2,2-difluoroethoxy)propanamide |
| SMILES | NC(=S)c1cn[nH]c1NC(=O)CCOCC(F)F |
| InChI | InChI=1S/C9H12F2N4O2S/c10-6(11)4-17-2-1-7(16)14-9-5(8(12)18)3-13-15-9/h3,6H,1-2,4H2,(H2,12,18)(H2,13,14,15,16) |
| InChIKey | YURSPOOFQSCWJX-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|