C7H8ClF3N2O2 — CID 103208655
3-(1-chloroethyl)-5-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazole (PubChem CID 103208655) has the molecular formula C7H8ClF3N2O2 and a molecular weight of 244.60 g/mol. Its IUPAC name is 3-(1-chloroethyl)-5-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazole.
| Compound Name | 3-(1-chloroethyl)-5-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 103208655 |
| Molecular Formula | C7H8ClF3N2O2 |
| Molecular Weight | 244.60 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 3-(1-chloroethyl)-5-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazole |
| SMILES | CC(Cl)c1noc(COCC(F)(F)F)n1 |
| InChI | InChI=1S/C7H8ClF3N2O2/c1-4(8)6-12-5(15-13-6)2-14-3-7(9,10)11/h4H,2-3H2,1H3 |
| InChIKey | GXDQFFRYPJDXAB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.60 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|