C12H22F2N2O3 — CID 103209063
3-(2,2-difluoroethoxy)-1-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]propan-1-one (PubChem CID 103209063) has the molecular formula C12H22F2N2O3 and a molecular weight of 280.31 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]propan-1-one.
| Compound Name | 3-(2,2-difluoroethoxy)-1-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]propan-1-one |
|---|---|
| PubChem CID | 103209063 |
| Molecular Formula | C12H22F2N2O3 |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]propan-1-one |
| SMILES | O=C(CCOCC(F)F)N1CCCN(CCO)CC1 |
| InChI | InChI=1S/C12H22F2N2O3/c13-11(14)10-19-9-2-12(18)16-4-1-3-15(5-6-16)7-8-17/h11,17H,1-10H2 |
| InChIKey | YFMFAJAWBOJJPV-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|