C11H20F2N4O3 — CID 103211602
2-[4-[3-(2,2-difluoroethoxy)propanoyl]piperazin-1-yl]-N'-hydroxyethanimidamide (PubChem CID 103211602) has the molecular formula C11H20F2N4O3 and a molecular weight of 294.30 g/mol. Its IUPAC name is 2-[4-[3-(2,2-difluoroethoxy)propanoyl]piperazin-1-yl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[4-[3-(2,2-difluoroethoxy)propanoyl]piperazin-1-yl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 103211602 |
| Molecular Formula | C11H20F2N4O3 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-[4-[3-(2,2-difluoroethoxy)propanoyl]piperazin-1-yl]-N'-hydroxyethanimidamide |
| SMILES | NC(CN1CCN(C(=O)CCOCC(F)F)CC1)=NO |
| InChI | InChI=1S/C11H20F2N4O3/c12-9(13)8-20-6-1-11(18)17-4-2-16(3-5-17)7-10(14)15-19/h9,19H,1-8H2,(H2,14,15) |
| InChIKey | LPAFTPGXJVKLBJ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|