C18H21N3O6S2 — CID 10320966
ethyl 6-(acetyloxymethyl)-2-methylsulfanyl-4-(2-methylsulfanyl-5-nitrophenyl)-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 10320966) has the molecular formula C18H21N3O6S2 and a molecular weight of 439.52 g/mol. Its IUPAC name is ethyl 6-(acetyloxymethyl)-2-methylsulfanyl-4-(2-methylsulfanyl-5-nitrophenyl)-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl 6-(acetyloxymethyl)-2-methylsulfanyl-4-(2-methylsulfanyl-5-nitrophenyl)-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 10320966 |
| Molecular Formula | C18H21N3O6S2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | ethyl 6-(acetyloxymethyl)-2-methylsulfanyl-4-(2-methylsulfanyl-5-nitrophenyl)-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(COC(C)=O)NC(SC)=NC1c1cc([N+](=O)[O-])ccc1SC |
| InChI | InChI=1S/C18H21N3O6S2/c1-5-26-17(23)15-13(9-27-10(2)22)19-18(29-4)20-16(15)12-8-11(21(24)25)6-7-14(12)28-3/h6-8,16H,5,9H2,1-4H3,(H,19,20) |
| InChIKey | JOPDWRIHFIPHOB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|