C8H13F3N2O2 — CID 103209728
N-[(E)-4-aminobut-2-enyl]-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 103209728) has the molecular formula C8H13F3N2O2 and a molecular weight of 226.20 g/mol. Its IUPAC name is N-[(E)-4-aminobut-2-enyl]-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-[(E)-4-aminobut-2-enyl]-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 103209728 |
| Molecular Formula | C8H13F3N2O2 |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | N-[(E)-4-aminobut-2-enyl]-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | NC/C=C/CNC(=O)COCC(F)(F)F |
| InChI | InChI=1S/C8H13F3N2O2/c9-8(10,11)6-15-5-7(14)13-4-2-1-3-12/h1-2H,3-6,12H2,(H,13,14)/b2-1+ |
| InChIKey | JXOLGBZEBQVVED-OWOJBTEDSA-N |
| XLogP | 0.20 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|