C14H14ClF3N2O — CID 103210673
4-[1-chloro-3-(2,2,2-trifluoroethoxy)propyl]-1-phenylpyrazole (PubChem CID 103210673) has the molecular formula C14H14ClF3N2O and a molecular weight of 318.73 g/mol. Its IUPAC name is 4-[1-chloro-3-(2,2,2-trifluoroethoxy)propyl]-1-phenylpyrazole.
| Compound Name | 4-[1-chloro-3-(2,2,2-trifluoroethoxy)propyl]-1-phenylpyrazole |
|---|---|
| PubChem CID | 103210673 |
| Molecular Formula | C14H14ClF3N2O |
| Molecular Weight | 318.73 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 4-[1-chloro-3-(2,2,2-trifluoroethoxy)propyl]-1-phenylpyrazole |
| SMILES | FC(F)(F)COCCC(Cl)c1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C14H14ClF3N2O/c15-13(6-7-21-10-14(16,17)18)11-8-19-20(9-11)12-4-2-1-3-5-12/h1-5,8-9,13H,6-7,10H2 |
| InChIKey | APOZLYPNYKTGAR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.73 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|