C12H11Br2F3N2O2 — CID 103211085
5-bromo-6-[1-bromo-3-(2,2,2-trifluoroethoxy)propyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 103211085) has the molecular formula C12H11Br2F3N2O2 and a molecular weight of 432.03 g/mol. Its IUPAC name is 5-bromo-6-[1-bromo-3-(2,2,2-trifluoroethoxy)propyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-bromo-6-[1-bromo-3-(2,2,2-trifluoroethoxy)propyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 103211085 |
| Molecular Formula | C12H11Br2F3N2O2 |
| Molecular Weight | 432.03 g/mol |
| Exact Mass | 429.91 |
| IUPAC Name | 5-bromo-6-[1-bromo-3-(2,2,2-trifluoroethoxy)propyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2cc(Br)c(C(Br)CCOCC(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C12H11Br2F3N2O2/c13-7(1-2-21-5-12(15,16)17)6-3-9-10(4-8(6)14)19-11(20)18-9/h3-4,7H,1-2,5H2,(H2,18,19,20) |
| InChIKey | XIQJKTOBCUNRPM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.03 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|