C16H16BrF3O — CID 103211157
1-[1-bromo-3-(2,2,2-trifluoroethoxy)propyl]-4-methylnaphthalene (PubChem CID 103211157) has the molecular formula C16H16BrF3O and a molecular weight of 361.20 g/mol. Its IUPAC name is 1-[1-bromo-3-(2,2,2-trifluoroethoxy)propyl]-4-methylnaphthalene.
| Compound Name | 1-[1-bromo-3-(2,2,2-trifluoroethoxy)propyl]-4-methylnaphthalene |
|---|---|
| PubChem CID | 103211157 |
| Molecular Formula | C16H16BrF3O |
| Molecular Weight | 361.20 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 1-[1-bromo-3-(2,2,2-trifluoroethoxy)propyl]-4-methylnaphthalene |
| SMILES | Cc1ccc(C(Br)CCOCC(F)(F)F)c2ccccc12 |
| InChI | InChI=1S/C16H16BrF3O/c1-11-6-7-14(13-5-3-2-4-12(11)13)15(17)8-9-21-10-16(18,19)20/h2-7,15H,8-10H2,1H3 |
| InChIKey | FLSPPDHQLFFNKX-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.20 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|