C10H18F2N4O — CID 103213778
[5-[2-(2,2-difluoroethoxy)ethyl]-4-propyl-1,2,4-triazol-3-yl]methanamine (PubChem CID 103213778) has the molecular formula C10H18F2N4O and a molecular weight of 248.28 g/mol. Its IUPAC name is [5-[2-(2,2-difluoroethoxy)ethyl]-4-propyl-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [5-[2-(2,2-difluoroethoxy)ethyl]-4-propyl-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 103213778 |
| Molecular Formula | C10H18F2N4O |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | [5-[2-(2,2-difluoroethoxy)ethyl]-4-propyl-1,2,4-triazol-3-yl]methanamine |
| SMILES | CCCn1c(CN)nnc1CCOCC(F)F |
| InChI | InChI=1S/C10H18F2N4O/c1-2-4-16-9(14-15-10(16)6-13)3-5-17-7-8(11)12/h8H,2-7,13H2,1H3 |
| InChIKey | GUFNLWJOZCUZNT-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|