C12H24N4O — CID 112594107
[5-(3-ethoxypropyl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]methanamine (PubChem CID 112594107) has the molecular formula C12H24N4O and a molecular weight of 240.35 g/mol. Its IUPAC name is [5-(3-ethoxypropyl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [5-(3-ethoxypropyl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 112594107 |
| Molecular Formula | C12H24N4O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | [5-(3-ethoxypropyl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]methanamine |
| SMILES | CCOCCCc1nnc(CN)n1CC(C)C |
| InChI | InChI=1S/C12H24N4O/c1-4-17-7-5-6-11-14-15-12(8-13)16(11)9-10(2)3/h10H,4-9,13H2,1-3H3 |
| InChIKey | ODYNKCQLFZLMNX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|