C10H18ClN3O — CID 115398551
3-(chloromethyl)-5-(ethoxymethyl)-4-(2-methylpropyl)-1,2,4-triazole (PubChem CID 115398551) has the molecular formula C10H18ClN3O and a molecular weight of 231.73 g/mol. Its IUPAC name is 3-(chloromethyl)-5-(ethoxymethyl)-4-(2-methylpropyl)-1,2,4-triazole.
| Compound Name | 3-(chloromethyl)-5-(ethoxymethyl)-4-(2-methylpropyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 115398551 |
| Molecular Formula | C10H18ClN3O |
| Molecular Weight | 231.73 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 3-(chloromethyl)-5-(ethoxymethyl)-4-(2-methylpropyl)-1,2,4-triazole |
| SMILES | CCOCc1nnc(CCl)n1CC(C)C |
| InChI | InChI=1S/C10H18ClN3O/c1-4-15-7-10-13-12-9(5-11)14(10)6-8(2)3/h8H,4-7H2,1-3H3 |
| InChIKey | JKLVNPJKKJFCME-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.73 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|