C8H11ClF3N3 — CID 115398650
3-(chloromethyl)-4-(2-methylpropyl)-5-(trifluoromethyl)-1,2,4-triazole (PubChem CID 115398650) has the molecular formula C8H11ClF3N3 and a molecular weight of 241.64 g/mol. Its IUPAC name is 3-(chloromethyl)-4-(2-methylpropyl)-5-(trifluoromethyl)-1,2,4-triazole.
| Compound Name | 3-(chloromethyl)-4-(2-methylpropyl)-5-(trifluoromethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 115398650 |
| Molecular Formula | C8H11ClF3N3 |
| Molecular Weight | 241.64 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 3-(chloromethyl)-4-(2-methylpropyl)-5-(trifluoromethyl)-1,2,4-triazole |
| SMILES | CC(C)Cn1c(CCl)nnc1C(F)(F)F |
| InChI | InChI=1S/C8H11ClF3N3/c1-5(2)4-15-6(3-9)13-14-7(15)8(10,11)12/h5H,3-4H2,1-2H3 |
| InChIKey | LZWJLFJXRVHTFR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.64 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|