C10H18ClN3O2S — CID 104523057
3-(chloromethyl)-4-(2-methylpropyl)-5-(1-methylsulfonylethyl)-1,2,4-triazole (PubChem CID 104523057) has the molecular formula C10H18ClN3O2S and a molecular weight of 279.79 g/mol. Its IUPAC name is 3-(chloromethyl)-4-(2-methylpropyl)-5-(1-methylsulfonylethyl)-1,2,4-triazole.
| Compound Name | 3-(chloromethyl)-4-(2-methylpropyl)-5-(1-methylsulfonylethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 104523057 |
| Molecular Formula | C10H18ClN3O2S |
| Molecular Weight | 279.79 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 3-(chloromethyl)-4-(2-methylpropyl)-5-(1-methylsulfonylethyl)-1,2,4-triazole |
| SMILES | CC(C)Cn1c(CCl)nnc1C(C)S(C)(=O)=O |
| InChI | InChI=1S/C10H18ClN3O2S/c1-7(2)6-14-9(5-11)12-13-10(14)8(3)17(4,15)16/h7-8H,5-6H2,1-4H3 |
| InChIKey | JYMGIIALPGAAAT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.79 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|