C12H16F3NO2 — CID 103214941
1-(3-methoxyphenyl)-3-(2,2,2-trifluoroethoxy)propan-2-amine (PubChem CID 103214941) has the molecular formula C12H16F3NO2 and a molecular weight of 263.26 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-(2,2,2-trifluoroethoxy)propan-2-amine.
| Compound Name | 1-(3-methoxyphenyl)-3-(2,2,2-trifluoroethoxy)propan-2-amine |
|---|---|
| PubChem CID | 103214941 |
| Molecular Formula | C12H16F3NO2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-(2,2,2-trifluoroethoxy)propan-2-amine |
| SMILES | COc1cccc(CC(N)COCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H16F3NO2/c1-17-11-4-2-3-9(6-11)5-10(16)7-18-8-12(13,14)15/h2-4,6,10H,5,7-8,16H2,1H3 |
| InChIKey | PWKVZAMTJVNMEW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |