C12H15ClIN — CID 103215428
1-(3-chloro-4-iodophenyl)-2-cyclopropyl-N-methylethanamine (PubChem CID 103215428) has the molecular formula C12H15ClIN and a molecular weight of 335.62 g/mol. Its IUPAC name is 1-(3-chloro-4-iodophenyl)-2-cyclopropyl-N-methylethanamine.
| Compound Name | 1-(3-chloro-4-iodophenyl)-2-cyclopropyl-N-methylethanamine |
|---|---|
| PubChem CID | 103215428 |
| Molecular Formula | C12H15ClIN |
| Molecular Weight | 335.62 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | 1-(3-chloro-4-iodophenyl)-2-cyclopropyl-N-methylethanamine |
| SMILES | CNC(CC1CC1)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C12H15ClIN/c1-15-12(6-8-2-3-8)9-4-5-11(14)10(13)7-9/h4-5,7-8,12,15H,2-3,6H2,1H3 |
| InChIKey | ZHQARTKIAQRZFO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.62 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|