C13H17ClIN — CID 103215395
1-(3-chloro-4-iodophenyl)-2-cyclobutyl-N-methylethanamine (PubChem CID 103215395) has the molecular formula C13H17ClIN and a molecular weight of 349.64 g/mol. Its IUPAC name is 1-(3-chloro-4-iodophenyl)-2-cyclobutyl-N-methylethanamine.
| Compound Name | 1-(3-chloro-4-iodophenyl)-2-cyclobutyl-N-methylethanamine |
|---|---|
| PubChem CID | 103215395 |
| Molecular Formula | C13H17ClIN |
| Molecular Weight | 349.64 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 1-(3-chloro-4-iodophenyl)-2-cyclobutyl-N-methylethanamine |
| SMILES | CNC(CC1CCC1)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C13H17ClIN/c1-16-13(7-9-3-2-4-9)10-5-6-12(15)11(14)8-10/h5-6,8-9,13,16H,2-4,7H2,1H3 |
| InChIKey | BDITYPZOVLYQPK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.64 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|