C13H18IN — CID 115863462
2-cyclobutyl-1-(2-iodophenyl)-N-methylethanamine (PubChem CID 115863462) has the molecular formula C13H18IN and a molecular weight of 315.20 g/mol. Its IUPAC name is 2-cyclobutyl-1-(2-iodophenyl)-N-methylethanamine.
| Compound Name | 2-cyclobutyl-1-(2-iodophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 115863462 |
| Molecular Formula | C13H18IN |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 2-cyclobutyl-1-(2-iodophenyl)-N-methylethanamine |
| SMILES | CNC(CC1CCC1)c1ccccc1I |
| InChI | InChI=1S/C13H18IN/c1-15-13(9-10-5-4-6-10)11-7-2-3-8-12(11)14/h2-3,7-8,10,13,15H,4-6,9H2,1H3 |
| InChIKey | ZJDCSWOYKRPQNK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|