C11H11ClIN — CID 103214490
1-(3-chloro-4-iodophenyl)-N-methylbut-3-yn-1-amine (PubChem CID 103214490) has the molecular formula C11H11ClIN and a molecular weight of 319.57 g/mol. Its IUPAC name is 1-(3-chloro-4-iodophenyl)-N-methylbut-3-yn-1-amine.
| Compound Name | 1-(3-chloro-4-iodophenyl)-N-methylbut-3-yn-1-amine |
|---|---|
| PubChem CID | 103214490 |
| Molecular Formula | C11H11ClIN |
| Molecular Weight | 319.57 g/mol |
| Exact Mass | 318.96 |
| IUPAC Name | 1-(3-chloro-4-iodophenyl)-N-methylbut-3-yn-1-amine |
| SMILES | C#CCC(NC)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C11H11ClIN/c1-3-4-11(14-2)8-5-6-10(13)9(12)7-8/h1,5-7,11,14H,4H2,2H3 |
| InChIKey | RFRLPFHRQVDDIO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.57 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|