C12H22F3NO — CID 103215495
1-(4-ethylcyclohexyl)-2-(2,2,2-trifluoroethoxy)ethanamine (PubChem CID 103215495) has the molecular formula C12H22F3NO and a molecular weight of 253.31 g/mol. Its IUPAC name is 1-(4-ethylcyclohexyl)-2-(2,2,2-trifluoroethoxy)ethanamine.
| Compound Name | 1-(4-ethylcyclohexyl)-2-(2,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 103215495 |
| Molecular Formula | C12H22F3NO |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 1-(4-ethylcyclohexyl)-2-(2,2,2-trifluoroethoxy)ethanamine |
| SMILES | CCC1CCC(C(N)COCC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H22F3NO/c1-2-9-3-5-10(6-4-9)11(16)7-17-8-12(13,14)15/h9-11H,2-8,16H2,1H3 |
| InChIKey | ZWLDYUXTDZDFER-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |